About N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide
N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide (PubChem CID 146014962) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide |
| PubChem CID | 146014962 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide |
| SMILES | CC(=O)Nc1cc2ncccc2c(-c2cccc(C)c2C)n1 |
| InChI | InChI=1S/C18H17N3O/c1-11-6-4-7-14(12(11)2)18-15-8-5-9-19-16(15)10-17(21-18)20-13(3)22/h4-10H,1-3H3,(H,20,21,22) |
| InChIKey | PKMWVRXJFLQNGE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide?
The IUPAC name of N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide (CID 146014962) is N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide.
What is the SMILES notation for N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide?
The canonical SMILES for N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide is CC(=O)Nc1cc2ncccc2c(-c2cccc(C)c2C)n1.
What is the InChIKey of N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide?
The InChIKey is PKMWVRXJFLQNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O/c1-11-6-4-7-14(12(11)2)18-15-8-5-9-19-16(15)10-17(21-18)20-13(3)22/h4-10H,1-3H3,(H,20,21,22).
What are the key properties of N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide?
N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide has a molecular weight of 291.35 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,3-dimethylphenyl)-1,6-naphthyridin-7-yl]acetamide is sourced from PubChem (CID 146014962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).