C21H26O2S — CID 146015102
(3R,3aR,8aR,9aR)-8a-methyl-5-methylidene-3-(phenylsulfanylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 146015102) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is (3R,3aR,8aR,9aR)-8a-methyl-5-methylidene-3-(phenylsulfanylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aR,8aR,9aR)-8a-methyl-5-methylidene-3-(phenylsulfanylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 146015102 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3R,3aR,8aR,9aR)-8a-methyl-5-methylidene-3-(phenylsulfanylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CSc4ccccc4)[C@H]3CC12 |
| InChI | InChI=1S/C21H26O2S/c1-14-7-6-10-21(2)12-19-16(11-18(14)21)17(20(22)23-19)13-24-15-8-4-3-5-9-15/h3-5,8-9,16-19H,1,6-7,10-13H2,2H3/t16-,17-,18?,19-,21-/m1/s1 |
| InChIKey | PBTPRBGADHTUMV-OXIPVZIXSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|