C20H23N3O4 — CID 146015140
4-amino-N-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-9-yl)methyl]benzamide (PubChem CID 146015140) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-amino-N-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-9-yl)methyl]benzamide.
| Compound Name | 4-amino-N-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 146015140 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-amino-N-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-9-yl)methyl]benzamide |
| SMILES | COc1c2c(c(CNC(=O)c3ccc(N)cc3)c3c1OCO3)CCN(C)C2 |
| InChI | InChI=1S/C20H23N3O4/c1-23-8-7-14-15(9-22-20(24)12-3-5-13(21)6-4-12)18-19(27-11-26-18)17(25-2)16(14)10-23/h3-6H,7-11,21H2,1-2H3,(H,22,24) |
| InChIKey | RJUMGHVXRMYIOD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|