C19H13N7O3S — CID 146015176
4-[[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-nitrophenyl)triazole (PubChem CID 146015176) has the molecular formula C19H13N7O3S and a molecular weight of 419.43 g/mol. Its IUPAC name is 4-[[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-nitrophenyl)triazole.
| Compound Name | 4-[[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-nitrophenyl)triazole |
|---|---|
| PubChem CID | 146015176 |
| Molecular Formula | C19H13N7O3S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 4-[[5-(1-benzofuran-2-yl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1-(4-nitrophenyl)triazole |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(CSc3n[nH]c(-c4cc5ccccc5o4)n3)nn2)cc1 |
| InChI | InChI=1S/C19H13N7O3S/c27-26(28)15-7-5-14(6-8-15)25-10-13(21-24-25)11-30-19-20-18(22-23-19)17-9-12-3-1-2-4-16(12)29-17/h1-10H,11H2,(H,20,22,23) |
| InChIKey | QTFBFEIBPNUQEO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|