C14H26O5S3 — CID 146018113
(1S,5R,7S)-7-(2-methoxyethoxymethoxymethyl)-8-methyl-2,2-bis(methylsulfanyl)-6-oxa-3-thiabicyclo[3.2.1]octan-5-ol (PubChem CID 146018113) has the molecular formula C14H26O5S3 and a molecular weight of 370.56 g/mol. Its IUPAC name is (1S,5R,7S)-7-(2-methoxyethoxymethoxymethyl)-8-methyl-2,2-bis(methylsulfanyl)-6-oxa-3-thiabicyclo[3.2.1]octan-5-ol.
| Compound Name | (1S,5R,7S)-7-(2-methoxyethoxymethoxymethyl)-8-methyl-2,2-bis(methylsulfanyl)-6-oxa-3-thiabicyclo[3.2.1]octan-5-ol |
|---|---|
| PubChem CID | 146018113 |
| Molecular Formula | C14H26O5S3 |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (1S,5R,7S)-7-(2-methoxyethoxymethoxymethyl)-8-methyl-2,2-bis(methylsulfanyl)-6-oxa-3-thiabicyclo[3.2.1]octan-5-ol |
| SMILES | COCCOCOC[C@H]1O[C@@]2(O)CSC(SC)(SC)[C@H]1C2C |
| InChI | InChI=1S/C14H26O5S3/c1-10-12-11(7-18-9-17-6-5-16-2)19-13(10,15)8-22-14(12,20-3)21-4/h10-12,15H,5-9H2,1-4H3/t10?,11-,12+,13+/m1/s1 |
| InChIKey | VLAUENHUWRHMHN-JUIFTKJUSA-N |
| XLogP | 2.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|