C13H20O5 — CID 146018208
(3aS,4S,6R,6aS)-4-methoxy-6-[(1Z,3E)-4-methoxybuta-1,3-dienyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 146018208) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3aS,4S,6R,6aS)-4-methoxy-6-[(1Z,3E)-4-methoxybuta-1,3-dienyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6R,6aS)-4-methoxy-6-[(1Z,3E)-4-methoxybuta-1,3-dienyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 146018208 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3aS,4S,6R,6aS)-4-methoxy-6-[(1Z,3E)-4-methoxybuta-1,3-dienyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CO/C=C/C=C\[C@H]1O[C@H](OC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H20O5/c1-13(2)17-10-9(7-5-6-8-14-3)16-12(15-4)11(10)18-13/h5-12H,1-4H3/b7-5-,8-6+/t9-,10+,11+,12+/m1/s1 |
| InChIKey | LKMJGOVJVXUEJR-WUFCHWIJSA-N |
| XLogP | 1.59 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|