About 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one
6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one (PubChem CID 146018251) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one.
Molecular Properties
| Compound Name | 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one |
| PubChem CID | 146018251 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one |
| SMILES | C[C@H]1CCC[C@H](Cc2cc3cc(O)cc(O)c3c(=O)o2)C1 |
| InChI | InChI=1S/C17H20O4/c1-10-3-2-4-11(5-10)6-14-8-12-7-13(18)9-15(19)16(12)17(20)21-14/h7-11,18-19H,2-6H2,1H3/t10-,11-/m0/s1 |
| InChIKey | JSPLICPLSKXJBM-QWRGUYRKSA-N |
| XLogP | 3.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one?
The IUPAC name of 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one (CID 146018251) is 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one.
What is the SMILES notation for 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one?
The canonical SMILES for 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one is C[C@H]1CCC[C@H](Cc2cc3cc(O)cc(O)c3c(=O)o2)C1.
What is the InChIKey of 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one?
The InChIKey is JSPLICPLSKXJBM-QWRGUYRKSA-N. The full InChI is InChI=1S/C17H20O4/c1-10-3-2-4-11(5-10)6-14-8-12-7-13(18)9-15(19)16(12)17(20)21-14/h7-11,18-19H,2-6H2,1H3/t10-,11-/m0/s1.
What are the key properties of 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one?
6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one has a molecular weight of 288.34 g/mol, XLogP of 3.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydroxy-3-[[(1S,3S)-3-methylcyclohexyl]methyl]isochromen-1-one is sourced from PubChem (CID 146018251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).