About N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide
N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide (PubChem CID 146018286) has the molecular formula C11H18F3NO
and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide |
| PubChem CID | 146018286 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide |
| SMILES | C=C(CCC(F)(F)F)C(CCC)NC(C)=O |
| InChI | InChI=1S/C11H18F3NO/c1-4-5-10(15-9(3)16)8(2)6-7-11(12,13)14/h10H,2,4-7H2,1,3H3,(H,15,16) |
| InChIKey | SUMVDOZICYHINB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
The IUPAC name of N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide (CID 146018286) is N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide.
What is the SMILES notation for N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
The canonical SMILES for N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide is C=C(CCC(F)(F)F)C(CCC)NC(C)=O.
What is the InChIKey of N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
The InChIKey is SUMVDOZICYHINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO/c1-4-5-10(15-9(3)16)8(2)6-7-11(12,13)14/h10H,2,4-7H2,1,3H3,(H,15,16).
What are the key properties of N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide has a molecular weight of 237.26 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide is sourced from PubChem (CID 146018286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).