About 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide
2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide (PubChem CID 146018296) has the molecular formula C11H17F4NO
and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide |
| PubChem CID | 146018296 |
| Molecular Formula | C11H17F4NO |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide |
| SMILES | C=C(CCC(F)(F)F)C(CCC)NC(=O)CF |
| InChI | InChI=1S/C11H17F4NO/c1-3-4-9(16-10(17)7-12)8(2)5-6-11(13,14)15/h9H,2-7H2,1H3,(H,16,17) |
| InChIKey | KORUBSBCCXIWSS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
The IUPAC name of 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide (CID 146018296) is 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide.
What is the SMILES notation for 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
The canonical SMILES for 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide is C=C(CCC(F)(F)F)C(CCC)NC(=O)CF.
What is the InChIKey of 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
The InChIKey is KORUBSBCCXIWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F4NO/c1-3-4-9(16-10(17)7-12)8(2)5-6-11(13,14)15/h9H,2-7H2,1H3,(H,16,17).
What are the key properties of 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide?
2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide has a molecular weight of 255.25 g/mol, XLogP of 3.14, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-(8,8,8-trifluoro-5-methylideneoctan-4-yl)acetamide is sourced from PubChem (CID 146018296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).