C33H43N7O6 — CID 146018349
(2S)-5-(carbamoylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]piperidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid (PubChem CID 146018349) has the molecular formula C33H43N7O6 and a molecular weight of 633.75 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]piperidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]piperidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 146018349 |
| Molecular Formula | C33H43N7O6 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]piperidine-2-carbonyl]amino]propanoyl]amino]pentanoic acid |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCCC[C@H]1C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C33H43N7O6/c1-35-27(18-21-10-3-2-4-11-21)31(43)40-17-8-7-15-28(40)30(42)39-26(19-22-20-37-24-13-6-5-12-23(22)24)29(41)38-25(32(44)45)14-9-16-36-33(34)46/h2-6,10-13,20,25-28,35,37H,7-9,14-19H2,1H3,(H,38,41)(H,39,42)(H,44,45)(H3,34,36,46)/t25-,26-,27+,28-/m0/s1 |
| InChIKey | GRFGUBWUIVUIRE-BPXGVECKSA-N |
| XLogP | 1.42 |
| TPSA | 198.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|