About 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide
2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide (PubChem CID 146018400) has the molecular formula C4H8N2O7
and a molecular weight of 196.11 g/mol. Its IUPAC name is 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide.
Molecular Properties
| Compound Name | 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide |
| PubChem CID | 146018400 |
| Molecular Formula | C4H8N2O7 |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide |
| SMILES | NC(=O)C(O)(O)OC(O)(O)C(N)=O |
| InChI | InChI=1S/C4H8N2O7/c5-1(7)3(9,10)13-4(11,12)2(6)8/h9-12H,(H2,5,7)(H2,6,8) |
| InChIKey | BXZVWKXOAIJWLO-UHFFFAOYSA-N |
| XLogP | -4.75 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide?
The IUPAC name of 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide (CID 146018400) is 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide.
What is the SMILES notation for 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide?
The canonical SMILES for 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide is NC(=O)C(O)(O)OC(O)(O)C(N)=O.
What is the InChIKey of 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide?
The InChIKey is BXZVWKXOAIJWLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O7/c5-1(7)3(9,10)13-4(11,12)2(6)8/h9-12H,(H2,5,7)(H2,6,8).
What are the key properties of 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide?
2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide has a molecular weight of 196.11 g/mol, XLogP of -4.75, 4 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,1-dihydroxy-2-oxoethoxy)-2,2-dihydroxyacetamide is sourced from PubChem (CID 146018400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).