About methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate
methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate (PubChem CID 146018460) has the molecular formula C15H16O3S
and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate |
| PubChem CID | 146018460 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=CC(=O)[C@@H]1CSc1ccccc1 |
| InChI | InChI=1S/C15H16O3S/c1-18-15(17)9-11-7-8-14(16)13(11)10-19-12-5-3-2-4-6-12/h2-8,11,13H,9-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | IVYFYXCMVPOSDA-DGCLKSJQSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate?
The IUPAC name of methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate (CID 146018460) is methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate.
What is the SMILES notation for methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate?
The canonical SMILES for methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate is COC(=O)C[C@H]1C=CC(=O)[C@@H]1CSc1ccccc1.
What is the InChIKey of methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate?
The InChIKey is IVYFYXCMVPOSDA-DGCLKSJQSA-N. The full InChI is InChI=1S/C15H16O3S/c1-18-15(17)9-11-7-8-14(16)13(11)10-19-12-5-3-2-4-6-12/h2-8,11,13H,9-10H2,1H3/t11-,13-/m1/s1.
What are the key properties of methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate?
methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate has a molecular weight of 276.36 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1S,5R)-4-oxo-5-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]acetate is sourced from PubChem (CID 146018460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).