C41H34NO3P — CID 146018639
10-oxo-1,4,7,8,9-pentakis-phenyl-10-propan-2-yl-4-aza-10λ5-phosphatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 146018639) has the molecular formula C41H34NO3P and a molecular weight of 619.70 g/mol. Its IUPAC name is 10-oxo-1,4,7,8,9-pentakis-phenyl-10-propan-2-yl-4-aza-10λ5-phosphatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 10-oxo-1,4,7,8,9-pentakis-phenyl-10-propan-2-yl-4-aza-10λ5-phosphatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 146018639 |
| Molecular Formula | C41H34NO3P |
| Molecular Weight | 619.70 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | 10-oxo-1,4,7,8,9-pentakis-phenyl-10-propan-2-yl-4-aza-10λ5-phosphatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(C)P1(=O)C2(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)C1(c1ccccc1)C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C41H34NO3P/c1-28(2)46(45)40(31-22-12-5-13-23-31)34(29-18-8-3-9-19-29)35(30-20-10-4-11-21-30)41(46,32-24-14-6-15-25-32)37-36(40)38(43)42(39(37)44)33-26-16-7-17-27-33/h3-28,36-37H,1-2H3 |
| InChIKey | UYDUURQZCBVJIX-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.70 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|