C17H23NO4 — CID 146018738
3-[(4R,5S)-4-hydroxy-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propyl 2,2-dimethylpropanoate (PubChem CID 146018738) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 3-[(4R,5S)-4-hydroxy-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(4R,5S)-4-hydroxy-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146018738 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-[(4R,5S)-4-hydroxy-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC[C@@H]1ON=C(c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C17H23NO4/c1-17(2,3)16(20)21-11-7-10-13-15(19)14(18-22-13)12-8-5-4-6-9-12/h4-6,8-9,13,15,19H,7,10-11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | LFBGCOHPOWXTFF-ZFWWWQNUSA-N |
| XLogP | 2.52 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|