C14H19NO3 — CID 146018741
(4R,5S)-5-butyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-4-ol (PubChem CID 146018741) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (4R,5S)-5-butyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-4-ol.
| Compound Name | (4R,5S)-5-butyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-4-ol |
|---|---|
| PubChem CID | 146018741 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (4R,5S)-5-butyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-4-ol |
| SMILES | CCCC[C@@H]1ON=C(c2ccc(OC)cc2)[C@H]1O |
| InChI | InChI=1S/C14H19NO3/c1-3-4-5-12-14(16)13(15-18-12)10-6-8-11(17-2)9-7-10/h6-9,12,14,16H,3-5H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | QBPRJRZCCAIFJC-JSGCOSHPSA-N |
| XLogP | 2.35 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |