C16H25FO5 — CID 146018800
(2S,3R,4R,5R,6R)-5-fluoro-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 146018800) has the molecular formula C16H25FO5 and a molecular weight of 316.37 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-5-fluoro-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2S,3R,4R,5R,6R)-5-fluoro-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 146018800 |
| Molecular Formula | C16H25FO5 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2S,3R,4R,5R,6R)-5-fluoro-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@H](OC)[C@H](OCC=C)[C@@H](OCC=C)[C@@H]1F |
| InChI | InChI=1S/C16H25FO5/c1-5-8-19-11-12-13(17)14(20-9-6-2)15(21-10-7-3)16(18-4)22-12/h5-7,12-16H,1-3,8-11H2,4H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | SHRMEZHRZJGZHD-LJIZCISZSA-N |
| XLogP | 2.04 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|