C16H26O5 — CID 146018804
(2S,3R,4S,6S)-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 146018804) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2S,3R,4S,6S)-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 146018804 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (2S,3R,4S,6S)-2-methoxy-3,4-bis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@@H]1C[C@H](OCC=C)[C@@H](OCC=C)[C@@H](OC)O1 |
| InChI | InChI=1S/C16H26O5/c1-5-8-18-12-13-11-14(19-9-6-2)15(20-10-7-3)16(17-4)21-13/h5-7,13-16H,1-3,8-12H2,4H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | WLFQTGBIPCZYGZ-JONQDZQNSA-N |
| XLogP | 2.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|