C18H30O6 — CID 146018812
[(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methanol (PubChem CID 146018812) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 146018812 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(2R,3R,4S,5R)-6-propan-2-yloxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methanol |
| SMILES | C=CCO[C@H]1[C@H](OCC=C)[C@@H](OCC=C)C(OC(C)C)O[C@@H]1CO |
| InChI | InChI=1S/C18H30O6/c1-6-9-20-15-14(12-19)24-18(23-13(4)5)17(22-11-8-3)16(15)21-10-7-2/h6-8,13-19H,1-3,9-12H2,4-5H3/t14-,15-,16+,17-,18?/m1/s1 |
| InChIKey | NFBJLUNABYHVLE-IHAUNJBESA-N |
| XLogP | 1.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|