About 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline
4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline (PubChem CID 146019182) has the molecular formula C10H10F4N2
and a molecular weight of 234.20 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline |
| PubChem CID | 146019182 |
| Molecular Formula | C10H10F4N2 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(N2CCC(F)(F)C2)c(F)c1 |
| InChI | InChI=1S/C10H10F4N2/c11-7-3-6(15)4-8(12)9(7)16-2-1-10(13,14)5-16/h3-4H,1-2,5,15H2 |
| InChIKey | RLOJBHZPRIAOOD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline?
The IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline (CID 146019182) is 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline.
What is the SMILES notation for 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline?
The canonical SMILES for 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline is Nc1cc(F)c(N2CCC(F)(F)C2)c(F)c1.
What is the InChIKey of 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline?
The InChIKey is RLOJBHZPRIAOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F4N2/c11-7-3-6(15)4-8(12)9(7)16-2-1-10(13,14)5-16/h3-4H,1-2,5,15H2.
What are the key properties of 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline?
4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline has a molecular weight of 234.20 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoropyrrolidin-1-yl)-3,5-difluoroaniline is sourced from PubChem (CID 146019182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).