C9H15N3O3S — CID 146019225
(2S)-2-acetamido-N-(2-sulfanylprop-2-enyl)butanediamide (PubChem CID 146019225) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is (2S)-2-acetamido-N-(2-sulfanylprop-2-enyl)butanediamide.
| Compound Name | (2S)-2-acetamido-N-(2-sulfanylprop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 146019225 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (2S)-2-acetamido-N-(2-sulfanylprop-2-enyl)butanediamide |
| SMILES | C=C(S)CNC(=O)[C@H](CC(N)=O)NC(C)=O |
| InChI | InChI=1S/C9H15N3O3S/c1-5(16)4-11-9(15)7(3-8(10)14)12-6(2)13/h7,16H,1,3-4H2,2H3,(H2,10,14)(H,11,15)(H,12,13)/t7-/m0/s1 |
| InChIKey | WGHGTULWMQJGSB-ZETCQYMHSA-N |
| XLogP | -1.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|