About 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one
7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one (PubChem CID 146019786) has the molecular formula C11H5F3N2O2
and a molecular weight of 254.17 g/mol. Its IUPAC name is 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one |
| PubChem CID | 146019786 |
| Molecular Formula | C11H5F3N2O2 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one |
| SMILES | O=c1[nH]oc2c1cnc1cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H5F3N2O2/c12-11(13,14)5-1-2-6-8(3-5)15-4-7-9(6)18-16-10(7)17/h1-4H,(H,16,17) |
| InChIKey | FKMLXUNGWMYFKM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one?
The IUPAC name of 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one (CID 146019786) is 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one.
What is the SMILES notation for 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one?
The canonical SMILES for 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one is O=c1[nH]oc2c1cnc1cc(C(F)(F)F)ccc12.
What is the InChIKey of 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one?
The InChIKey is FKMLXUNGWMYFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F3N2O2/c12-11(13,14)5-1-2-6-8(3-5)15-4-7-9(6)18-16-10(7)17/h1-4H,(H,16,17).
What are the key properties of 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one?
7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one has a molecular weight of 254.17 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-[1,2]oxazolo[4,5-c]quinolin-3-one is sourced from PubChem (CID 146019786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).