C18H34O4Si2 — CID 146019852
[(1S,4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-5-trimethylsilylcyclopent-2-en-1-yl] acetate (PubChem CID 146019852) has the molecular formula C18H34O4Si2 and a molecular weight of 370.64 g/mol. Its IUPAC name is [(1S,4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-5-trimethylsilylcyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-5-trimethylsilylcyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 146019852 |
| Molecular Formula | C18H34O4Si2 |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(1S,4S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-5-trimethylsilylcyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(C=O)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C18H34O4Si2/c1-13(20)22-16-10-14(11-19)15(17(16)23(5,6)7)12-21-24(8,9)18(2,3)4/h10-11,15-17H,12H2,1-9H3/t15-,16+,17+/m1/s1 |
| InChIKey | KYJUPSJTROJYIT-IKGGRYGDSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|