C35H31N5O6 — CID 146020016
tert-butyl 3-[1,2-bis[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]ethyl]indole-1-carboxylate (PubChem CID 146020016) has the molecular formula C35H31N5O6 and a molecular weight of 617.66 g/mol. Its IUPAC name is tert-butyl 3-[1,2-bis[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]ethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[1,2-bis[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 146020016 |
| Molecular Formula | C35H31N5O6 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | tert-butyl 3-[1,2-bis[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]ethyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(CNC(=O)C(=O)c2c[nH]c3ccccc23)NC(=O)C(=O)c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C35H31N5O6/c1-35(2,3)46-34(45)40-19-25(22-12-6-9-15-29(22)40)28(39-33(44)31(42)24-17-37-27-14-8-5-11-21(24)27)18-38-32(43)30(41)23-16-36-26-13-7-4-10-20(23)26/h4-17,19,28,36-37H,18H2,1-3H3,(H,38,43)(H,39,44) |
| InChIKey | YCMKMWPZYNEOPK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|