C56H39N4OP — CID 146020024
2-[3-[6-(3-diphenylphosphorylphenyl)-2-pyridinyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 146020024) has the molecular formula C56H39N4OP and a molecular weight of 814.93 g/mol. Its IUPAC name is 2-[3-[6-(3-diphenylphosphorylphenyl)-2-pyridinyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-[6-(3-diphenylphosphorylphenyl)-2-pyridinyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146020024 |
| Molecular Formula | C56H39N4OP |
| Molecular Weight | 814.93 g/mol |
| Exact Mass | 814.29 |
| IUPAC Name | 2-[3-[6-(3-diphenylphosphorylphenyl)-2-pyridinyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cccc(-c2cccc(-c3cccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3)n2)c1 |
| InChI | InChI=1S/C56H39N4OP/c61-62(49-23-9-3-10-24-49,50-25-11-4-12-26-50)51-27-14-21-47(39-51)53-29-15-28-52(57-53)46-20-13-22-48(38-46)56-59-54(44-34-30-42(31-35-44)40-16-5-1-6-17-40)58-55(60-56)45-36-32-43(33-37-45)41-18-7-2-8-19-41/h1-39H |
| InChIKey | RVYIJPFSMODOHR-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.93 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|