C24H54O5Si3 — CID 146020058
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 146020058) has the molecular formula C24H54O5Si3 and a molecular weight of 506.95 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 146020058 |
| Molecular Formula | C24H54O5Si3 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxyoxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H54O5Si3/c1-22(2,3)30(11,12)26-17-18-19(28-31(13,14)23(4,5)6)20(21(25-10)27-18)29-32(15,16)24(7,8)9/h18-21H,17H2,1-16H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | IDYHJGFVOZCDCW-XRXFAXGQSA-N |
| XLogP | 7.16 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|