C12H20O3 — CID 146020069
(E)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-1-en-3-one (PubChem CID 146020069) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (E)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-1-en-3-one.
| Compound Name | (E)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 146020069 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (E)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-1-en-3-one |
| SMILES | CC1(C)OC[C@H](/C=C/C(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H20O3/c1-11(2,3)10(13)7-6-9-8-14-12(4,5)15-9/h6-7,9H,8H2,1-5H3/b7-6+/t9-/m0/s1 |
| InChIKey | FHJHWWCXRFKDFX-UCUJLANTSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|