About [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate
[(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate (PubChem CID 146020071) has the molecular formula C14H20O8
and a molecular weight of 316.31 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate |
| PubChem CID | 146020071 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC(=O)C[C@@H]1C.CC(=O)O[C@H]1OC(=O)C[C@@H]1C |
| InChI | InChI=1S/2C7H10O4/c2*1-4-3-6(9)11-7(4)10-5(2)8/h2*4,7H,3H2,1-2H3/t4-,7+;4-,7-/m00/s1 |
| InChIKey | YDQWYGUTMSNYFU-YUZFKGPJSA-N |
| XLogP | 0.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate?
The IUPAC name of [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate (CID 146020071) is [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate.
What is the SMILES notation for [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate?
The canonical SMILES for [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate is CC(=O)O[C@@H]1OC(=O)C[C@@H]1C.CC(=O)O[C@H]1OC(=O)C[C@@H]1C.
What is the InChIKey of [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate?
The InChIKey is YDQWYGUTMSNYFU-YUZFKGPJSA-N. The full InChI is InChI=1S/2C7H10O4/c2*1-4-3-6(9)11-7(4)10-5(2)8/h2*4,7H,3H2,1-2H3/t4-,7+;4-,7-/m00/s1.
What are the key properties of [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate?
[(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate has a molecular weight of 316.31 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-methyl-5-oxooxolan-2-yl] acetate;[(2R,3S)-3-methyl-5-oxooxolan-2-yl] acetate is sourced from PubChem (CID 146020071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).