C24H38O2Si — CID 146020458
1-[(1'R,2'R,5'S,6'R,10'S)-10'-tri(propan-2-yl)silyloxyspiro[cyclopropane-1,11'-tricyclo[4.3.1.12,5]undeca-3,7-diene]-8'-yl]ethanone (PubChem CID 146020458) has the molecular formula C24H38O2Si and a molecular weight of 386.65 g/mol. Its IUPAC name is 1-[(1'R,2'R,5'S,6'R,10'S)-10'-tri(propan-2-yl)silyloxyspiro[cyclopropane-1,11'-tricyclo[4.3.1.12,5]undeca-3,7-diene]-8'-yl]ethanone.
| Compound Name | 1-[(1'R,2'R,5'S,6'R,10'S)-10'-tri(propan-2-yl)silyloxyspiro[cyclopropane-1,11'-tricyclo[4.3.1.12,5]undeca-3,7-diene]-8'-yl]ethanone |
|---|---|
| PubChem CID | 146020458 |
| Molecular Formula | C24H38O2Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-[(1'R,2'R,5'S,6'R,10'S)-10'-tri(propan-2-yl)silyloxyspiro[cyclopropane-1,11'-tricyclo[4.3.1.12,5]undeca-3,7-diene]-8'-yl]ethanone |
| SMILES | CC(=O)C1=C[C@H]2[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C1)[C@H]1C=C[C@@H]2C12CC2 |
| InChI | InChI=1S/C24H38O2Si/c1-14(2)27(15(3)4,16(5)6)26-23-19-12-18(17(7)25)13-20(23)22-9-8-21(19)24(22)10-11-24/h8-9,12,14-16,19-23H,10-11,13H2,1-7H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | UYLRRFUINJAQPI-XNBWIAOKSA-N |
| XLogP | 6.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|