C33H61ClO3Si2 — CID 146020477
(1'R,2'R,3'R,6'R,7'S,9'S,11'R)-4'-chloro-3'-methyl-9',11'-bis[tri(propan-2-yl)silyloxy]spiro[cyclopropane-1,12'-tricyclo[5.3.1.12,6]dodec-4-ene]-3'-ol (PubChem CID 146020477) has the molecular formula C33H61ClO3Si2 and a molecular weight of 597.47 g/mol. Its IUPAC name is (1'R,2'R,3'R,6'R,7'S,9'S,11'R)-4'-chloro-3'-methyl-9',11'-bis[tri(propan-2-yl)silyloxy]spiro[cyclopropane-1,12'-tricyclo[5.3.1.12,6]dodec-4-ene]-3'-ol.
| Compound Name | (1'R,2'R,3'R,6'R,7'S,9'S,11'R)-4'-chloro-3'-methyl-9',11'-bis[tri(propan-2-yl)silyloxy]spiro[cyclopropane-1,12'-tricyclo[5.3.1.12,6]dodec-4-ene]-3'-ol |
|---|---|
| PubChem CID | 146020477 |
| Molecular Formula | C33H61ClO3Si2 |
| Molecular Weight | 597.47 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | (1'R,2'R,3'R,6'R,7'S,9'S,11'R)-4'-chloro-3'-methyl-9',11'-bis[tri(propan-2-yl)silyloxy]spiro[cyclopropane-1,12'-tricyclo[5.3.1.12,6]dodec-4-ene]-3'-ol |
| SMILES | CC(C)[Si](O[C@H]1C[C@@H]2[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C1)[C@@H]1C3(CC3)[C@H]2C=C(Cl)[C@]1(C)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H61ClO3Si2/c1-19(2)38(20(3)4,21(5)6)36-25-16-26-28-18-29(34)32(13,35)31(33(28)14-15-33)27(17-25)30(26)37-39(22(7)8,23(9)10)24(11)12/h18-28,30-31,35H,14-17H2,1-13H3/t25-,26-,27-,28-,30+,31-,32-/m0/s1 |
| InChIKey | QSBRQOZTBSNKTG-HGCYATDZSA-N |
| XLogP | 10.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.47 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|