About 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile
2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile (PubChem CID 146020594) has the molecular formula C15H12ClN5O
and a molecular weight of 313.75 g/mol. Its IUPAC name is 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile |
| PubChem CID | 146020594 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile |
| SMILES | Cn1c(=O)n(C)c2cc(Nc3ccnc(Cl)c3C#N)ccc21 |
| InChI | InChI=1S/C15H12ClN5O/c1-20-12-4-3-9(7-13(12)21(2)15(20)22)19-11-5-6-18-14(16)10(11)8-17/h3-7H,1-2H3,(H,18,19) |
| InChIKey | OTSZAULBNXSOMT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile?
The IUPAC name of 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile (CID 146020594) is 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile.
What is the SMILES notation for 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile?
The canonical SMILES for 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile is Cn1c(=O)n(C)c2cc(Nc3ccnc(Cl)c3C#N)ccc21.
What is the InChIKey of 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile?
The InChIKey is OTSZAULBNXSOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN5O/c1-20-12-4-3-9(7-13(12)21(2)15(20)22)19-11-5-6-18-14(16)10(11)8-17/h3-7H,1-2H3,(H,18,19).
What are the key properties of 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile?
2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile has a molecular weight of 313.75 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)amino]pyridine-3-carbonitrile is sourced from PubChem (CID 146020594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).