C30H43N4O3+ — CID 146021212
[2-[[1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-diethyl-methylazanium (PubChem CID 146021212) has the molecular formula C30H43N4O3+ and a molecular weight of 507.70 g/mol. Its IUPAC name is [2-[[1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-diethyl-methylazanium.
| Compound Name | [2-[[1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-diethyl-methylazanium |
|---|---|
| PubChem CID | 146021212 |
| Molecular Formula | C30H43N4O3+ |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | [2-[[1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CC(=O)/N=N/c1c(O)n(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2ccccc12 |
| InChI | InChI=1S/C30H42N4O3/c1-10-34(9,11-2)19-25(35)31-32-26-21-14-12-13-15-24(21)33(28(26)37)18-20-16-22(29(3,4)5)27(36)23(17-20)30(6,7)8/h12-17H,10-11,18-19H2,1-9H3,(H-,31,35,36,37)/p+1 |
| InChIKey | OGSHJDWUEYQZDE-UHFFFAOYSA-O |
| XLogP | 6.79 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|