C13H16N4O4S — CID 146024582
5-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-2-methoxybenzamide (PubChem CID 146024582) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is 5-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-2-methoxybenzamide.
| Compound Name | 5-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 146024582 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2cnc[nH]2)cc1C(N)=O |
| InChI | InChI=1S/C13H16N4O4S/c1-21-12-3-2-10(6-11(12)13(14)18)22(19,20)17-5-4-9-7-15-8-16-9/h2-3,6-8,17H,4-5H2,1H3,(H2,14,18)(H,15,16) |
| InChIKey | ZMYIPTXRGXCWOD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |