C9H7N3O4S — CID 146025046
N-cyano-3-methyl-2-oxo-1,3-benzoxazole-5-sulfonamide (PubChem CID 146025046) has the molecular formula C9H7N3O4S and a molecular weight of 253.24 g/mol. Its IUPAC name is N-cyano-3-methyl-2-oxo-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-cyano-3-methyl-2-oxo-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 146025046 |
| Molecular Formula | C9H7N3O4S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-cyano-3-methyl-2-oxo-1,3-benzoxazole-5-sulfonamide |
| SMILES | Cn1c(=O)oc2ccc(S(=O)(=O)NC#N)cc21 |
| InChI | InChI=1S/C9H7N3O4S/c1-12-7-4-6(17(14,15)11-5-10)2-3-8(7)16-9(12)13/h2-4,11H,1H3 |
| InChIKey | XSZZTBOOCLRGKW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|