About [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine
[(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine (PubChem CID 146025684) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine |
| PubChem CID | 146025684 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine |
| SMILES | C=CCOc1ccc2c(c1[C@H]1C[C@@H]1CN)CCO2 |
| InChI | InChI=1S/C15H19NO2/c1-2-6-17-14-4-3-13-11(5-7-18-13)15(14)12-8-10(12)9-16/h2-4,10,12H,1,5-9,16H2/t10-,12+/m1/s1 |
| InChIKey | DPQLVLTYJLTOLU-PWSUYJOCSA-N |
| XLogP | 2.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine?
The IUPAC name of [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine (CID 146025684) is [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine.
What is the SMILES notation for [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine?
The canonical SMILES for [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine is C=CCOc1ccc2c(c1[C@H]1C[C@@H]1CN)CCO2.
What is the InChIKey of [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine?
The InChIKey is DPQLVLTYJLTOLU-PWSUYJOCSA-N. The full InChI is InChI=1S/C15H19NO2/c1-2-6-17-14-4-3-13-11(5-7-18-13)15(14)12-8-10(12)9-16/h2-4,10,12H,1,5-9,16H2/t10-,12+/m1/s1.
What are the key properties of [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine?
[(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine has a molecular weight of 245.32 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-(5-prop-2-enoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine is sourced from PubChem (CID 146025684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).