About 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine
5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine (PubChem CID 146025714) has the molecular formula C20H16N6O
and a molecular weight of 356.39 g/mol. Its IUPAC name is 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine |
| PubChem CID | 146025714 |
| Molecular Formula | C20H16N6O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine |
| SMILES | Cc1cc(Oc2nccn3ccnc23)ccc1-c1c(C)ncc2nccn12 |
| InChI | InChI=1S/C20H16N6O/c1-13-11-15(27-20-19-22-5-8-25(19)9-6-23-20)3-4-16(13)18-14(2)24-12-17-21-7-10-26(17)18/h3-12H,1-2H3 |
| InChIKey | OYCVPQJTTXMMCY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine?
The IUPAC name of 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine (CID 146025714) is 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine?
The canonical SMILES for 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine is Cc1cc(Oc2nccn3ccnc23)ccc1-c1c(C)ncc2nccn12.
What is the InChIKey of 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine?
The InChIKey is OYCVPQJTTXMMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N6O/c1-13-11-15(27-20-19-22-5-8-25(19)9-6-23-20)3-4-16(13)18-14(2)24-12-17-21-7-10-26(17)18/h3-12H,1-2H3.
What are the key properties of 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine?
5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine has a molecular weight of 356.39 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-imidazo[1,2-a]pyrazin-8-yloxy-2-methylphenyl)-6-methylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 146025714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).