About 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine
1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine (PubChem CID 146025728) has the molecular formula C21H13F3N4O
and a molecular weight of 394.36 g/mol. Its IUPAC name is 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine |
| PubChem CID | 146025728 |
| Molecular Formula | C21H13F3N4O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine |
| SMILES | FC(F)(F)c1cc(Oc2nccn3cccc23)ccc1-c1cccc2nccn12 |
| InChI | InChI=1S/C21H13F3N4O/c22-21(23,24)16-13-14(29-20-18-4-2-10-27(18)11-8-26-20)6-7-15(16)17-3-1-5-19-25-9-12-28(17)19/h1-13H |
| InChIKey | DRHIFXXZSQOMKD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine?
The IUPAC name of 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine (CID 146025728) is 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine?
The canonical SMILES for 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine is FC(F)(F)c1cc(Oc2nccn3cccc23)ccc1-c1cccc2nccn12.
What is the InChIKey of 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine?
The InChIKey is DRHIFXXZSQOMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13F3N4O/c22-21(23,24)16-13-14(29-20-18-4-2-10-27(18)11-8-26-20)6-7-15(16)17-3-1-5-19-25-9-12-28(17)19/h1-13H.
What are the key properties of 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine?
1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine has a molecular weight of 394.36 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]pyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 146025728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).