About 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine
8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine (PubChem CID 146025729) has the molecular formula C20H12F3N5O
and a molecular weight of 395.34 g/mol. Its IUPAC name is 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine |
| PubChem CID | 146025729 |
| Molecular Formula | C20H12F3N5O |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine |
| SMILES | FC(F)(F)c1cc(Oc2nccn3ccnc23)ccc1-c1cccc2nccn12 |
| InChI | InChI=1S/C20H12F3N5O/c21-20(22,23)15-12-13(29-19-18-25-6-9-27(18)10-7-26-19)4-5-14(15)16-2-1-3-17-24-8-11-28(16)17/h1-12H |
| InChIKey | NHJDTTMQXSWJTJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine?
The IUPAC name of 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine (CID 146025729) is 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine?
The canonical SMILES for 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine is FC(F)(F)c1cc(Oc2nccn3ccnc23)ccc1-c1cccc2nccn12.
What is the InChIKey of 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine?
The InChIKey is NHJDTTMQXSWJTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F3N5O/c21-20(22,23)15-12-13(29-19-18-25-6-9-27(18)10-7-26-19)4-5-14(15)16-2-1-3-17-24-8-11-28(16)17/h1-12H.
What are the key properties of 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine?
8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine has a molecular weight of 395.34 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-imidazo[1,2-a]pyridin-5-yl-3-(trifluoromethyl)phenoxy]imidazo[1,2-a]pyrazine is sourced from PubChem (CID 146025729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).