About 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea
3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea (PubChem CID 146025772) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea |
| PubChem CID | 146025772 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(CCN2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-22(2)20(24)21-19-9-7-16(8-10-19)11-13-23-14-12-17-5-3-4-6-18(17)15-23/h3-10H,11-15H2,1-2H3,(H,21,24) |
| InChIKey | SUFBKKCSBFKHMR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea?
The IUPAC name of 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea (CID 146025772) is 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea?
The canonical SMILES for 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea is CN(C)C(=O)Nc1ccc(CCN2CCc3ccccc3C2)cc1.
What is the InChIKey of 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea?
The InChIKey is SUFBKKCSBFKHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-22(2)20(24)21-19-9-7-16(8-10-19)11-13-23-14-12-17-5-3-4-6-18(17)15-23/h3-10H,11-15H2,1-2H3,(H,21,24).
What are the key properties of 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea?
3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea has a molecular weight of 323.44 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-1,1-dimethylurea is sourced from PubChem (CID 146025772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).