C23H25NO4 — CID 146025821
[(6aR)-11-acetyloxy-9-ethyl-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] acetate (PubChem CID 146025821) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(6aR)-11-acetyloxy-9-ethyl-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] acetate.
| Compound Name | [(6aR)-11-acetyloxy-9-ethyl-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] acetate |
|---|---|
| PubChem CID | 146025821 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [(6aR)-11-acetyloxy-9-ethyl-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] acetate |
| SMILES | CCc1cc2c(c(OC(C)=O)c1OC(C)=O)-c1cccc3c1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C23H25NO4/c1-5-15-11-17-12-19-20-16(9-10-24(19)4)7-6-8-18(20)21(17)23(28-14(3)26)22(15)27-13(2)25/h6-8,11,19H,5,9-10,12H2,1-4H3/t19-/m1/s1 |
| InChIKey | BWRISDCHRCNQPM-LJQANCHMSA-N |
| XLogP | 3.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|