C15H11Cl2NO — CID 146025919
(4R)-4-(3,4-dichlorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 146025919) has the molecular formula C15H11Cl2NO and a molecular weight of 292.17 g/mol. Its IUPAC name is (4R)-4-(3,4-dichlorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-(3,4-dichlorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 146025919 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (4R)-4-(3,4-dichlorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | Clc1ccc([C@@H]2COC(c3ccccc3)=N2)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO/c16-12-7-6-11(8-13(12)17)14-9-19-15(18-14)10-4-2-1-3-5-10/h1-8,14H,9H2/t14-/m0/s1 |
| InChIKey | JBWNLCTZJLUJDD-AWEZNQCLSA-N |
| XLogP | 4.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |