C9H17ClN4O6 — CID 146026065
5-amino-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 146026065) has the molecular formula C9H17ClN4O6 and a molecular weight of 312.71 g/mol. Its IUPAC name is 5-amino-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione;hydrochloride.
| Compound Name | 5-amino-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 146026065 |
| Molecular Formula | C9H17ClN4O6 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-amino-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.Nc1c(NC[C@H](O)[C@H](O)[C@H](O)CO)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H16N4O6.ClH/c10-5-7(12-9(19)13-8(5)18)11-1-3(15)6(17)4(16)2-14;/h3-4,6,14-17H,1-2,10H2,(H3,11,12,13,18,19);1H/t3-,4+,6-;/m0./s1 |
| InChIKey | VGAFXPBLNINPEY-ZUOBHZEMSA-N |
| XLogP | -3.45 |
| TPSA | 184.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |