About ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate
ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate (PubChem CID 146026390) has the molecular formula C12H19N3O3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate |
| PubChem CID | 146026390 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)C1(O)N=C(N)S/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C12H19N3O3S/c1-2-18-10(16)12(17)9(19-11(13)15-12)14-8-6-4-3-5-7-8/h8,17H,2-7H2,1H3,(H2,13,15)/b14-9- |
| InChIKey | WGJMAJQQMVWCLM-ZROIWOOFSA-N |
| XLogP | 1.03 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate (CID 146026390) is ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate is CCOC(=O)C1(O)N=C(N)S/C1=N\C1CCCCC1.
What is the InChIKey of ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate?
The InChIKey is WGJMAJQQMVWCLM-ZROIWOOFSA-N. The full InChI is InChI=1S/C12H19N3O3S/c1-2-18-10(16)12(17)9(19-11(13)15-12)14-8-6-4-3-5-7-8/h8,17H,2-7H2,1H3,(H2,13,15)/b14-9-.
What are the key properties of ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate?
ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate has a molecular weight of 285.37 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-5-cyclohexylimino-4-hydroxy-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 146026390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).