C18H15ClINO3S — CID 146026666
methyl (2R,4R)-2-(2-chlorophenyl)-3-(4-iodobenzoyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 146026666) has the molecular formula C18H15ClINO3S and a molecular weight of 487.75 g/mol. Its IUPAC name is methyl (2R,4R)-2-(2-chlorophenyl)-3-(4-iodobenzoyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2R,4R)-2-(2-chlorophenyl)-3-(4-iodobenzoyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 146026666 |
| Molecular Formula | C18H15ClINO3S |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 486.95 |
| IUPAC Name | methyl (2R,4R)-2-(2-chlorophenyl)-3-(4-iodobenzoyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CS[C@H](c2ccccc2Cl)N1C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H15ClINO3S/c1-24-18(23)15-10-25-17(13-4-2-3-5-14(13)19)21(15)16(22)11-6-8-12(20)9-7-11/h2-9,15,17H,10H2,1H3/t15-,17+/m0/s1 |
| InChIKey | BTAYICGGXFHMDH-DOTOQJQBSA-N |
| XLogP | 4.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|