methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate

C9H14FNO2 — CID 146026783

IUPACmethyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate
SMILESCOC(=O)C12CCCN1CC(F)C2
InChIInChI=1S/C9H14FNO2/c1-13-8(12)9-3-2-4-11(9)6-7(10)5-9/h7H,2-6H2,1H3
InChIKeyFSIUNPRMYQMELM-UHFFFAOYSA-N
MW187.21 g/mol
LogP0.74
Rot. Bonds1

About methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate

methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 146026783) has the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. Its IUPAC name is methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.

Molecular Properties

Compound Namemethyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate
PubChem CID146026783
Molecular FormulaC9H14FNO2
Molecular Weight187.21 g/mol
Exact Mass187.10
IUPAC Namemethyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate
SMILESCOC(=O)C12CCCN1CC(F)C2
InChIInChI=1S/C9H14FNO2/c1-13-8(12)9-3-2-4-11(9)6-7(10)5-9/h7H,2-6H2,1H3
InChIKeyFSIUNPRMYQMELM-UHFFFAOYSA-N
XLogP0.74
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.21
LogP ≤ 50.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate?
The IUPAC name of methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (CID 146026783) is methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
What is the SMILES notation for methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate?
The canonical SMILES for methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate is COC(=O)C12CCCN1CC(F)C2.
What is the InChIKey of methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate?
The InChIKey is FSIUNPRMYQMELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO2/c1-13-8(12)9-3-2-4-11(9)6-7(10)5-9/h7H,2-6H2,1H3.
What are the key properties of methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate?
methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate has a molecular weight of 187.21 g/mol, XLogP of 0.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate is sourced from PubChem (CID 146026783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).