About propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate
propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate (PubChem CID 146026804) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate |
| PubChem CID | 146026804 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CC(C)OC(=O)c1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C10H16N2O3/c1-6(2)14-8(13)7-11-9(15-12-7)10(3,4)5/h6H,1-5H3 |
| InChIKey | YQOIEXNWBDPUNR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate (CID 146026804) is propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate is CC(C)OC(=O)c1noc(C(C)(C)C)n1.
What is the InChIKey of propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is YQOIEXNWBDPUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-6(2)14-8(13)7-11-9(15-12-7)10(3,4)5/h6H,1-5H3.
What are the key properties of propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate?
propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 212.25 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-tert-butyl-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 146026804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).