C15H19NO6 — CID 14602703
[(3aR,5S,6R,6aR)-6-(hydroxyamino)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate (PubChem CID 14602703) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-6-(hydroxyamino)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate.
| Compound Name | [(3aR,5S,6R,6aR)-6-(hydroxyamino)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 14602703 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(3aR,5S,6R,6aR)-6-(hydroxyamino)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](NO)[C@H]2O1 |
| InChI | InChI=1S/C15H19NO6/c1-15(2)21-12-11(16-18)10(20-14(12)22-15)8-19-13(17)9-6-4-3-5-7-9/h3-7,10-12,14,16,18H,8H2,1-2H3/t10-,11-,12-,14-/m1/s1 |
| InChIKey | RUDPCEWYAIZTRJ-HKUMRIAESA-N |
| XLogP | 1.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|