C11H22BN2O5- — CID 146027039
3-[(3aR,4S,5S,6aR)-5-amino-5-carboxy-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]propyl-trihydroxyboranuide (PubChem CID 146027039) has the molecular formula C11H22BN2O5- and a molecular weight of 273.12 g/mol. Its IUPAC name is 3-[(3aR,4S,5S,6aR)-5-amino-5-carboxy-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]propyl-trihydroxyboranuide.
| Compound Name | 3-[(3aR,4S,5S,6aR)-5-amino-5-carboxy-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]propyl-trihydroxyboranuide |
|---|---|
| PubChem CID | 146027039 |
| Molecular Formula | C11H22BN2O5- |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 3-[(3aR,4S,5S,6aR)-5-amino-5-carboxy-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]propyl-trihydroxyboranuide |
| SMILES | N[C@@]1(C(=O)O)C[C@H]2CNC[C@H]2[C@@H]1CCC[B-](O)(O)O |
| InChI | InChI=1S/C11H22BN2O5/c13-11(10(15)16)4-7-5-14-6-8(7)9(11)2-1-3-12(17,18)19/h7-9,14,17-19H,1-6,13H2,(H,15,16)/q-1/t7-,8+,9-,11-/m0/s1 |
| InChIKey | WOVPMRKEMBIWOY-DKIAZLNASA-N |
| XLogP | -1.68 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|