C21H24F2N6O5 — CID 146027221
[3-[6-[3-(1,3-dihydroxy-2-methylpropoxy)iminoazetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146027221) has the molecular formula C21H24F2N6O5 and a molecular weight of 478.46 g/mol. Its IUPAC name is [3-[6-[3-(1,3-dihydroxy-2-methylpropoxy)iminoazetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[6-[3-(1,3-dihydroxy-2-methylpropoxy)iminoazetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146027221 |
| Molecular Formula | C21H24F2N6O5 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [3-[6-[3-(1,3-dihydroxy-2-methylpropoxy)iminoazetidin-1-yl]-5-fluoro-3-pyridinyl]-2-fluorophenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | CC(CO)C(O)ON=C1CN(c2ncc(-c3cccc(COC(=O)N=C(N)N)c3F)cc2F)C1 |
| InChI | InChI=1S/C21H24F2N6O5/c1-11(9-30)19(31)34-28-14-7-29(8-14)18-16(22)5-13(6-26-18)15-4-2-3-12(17(15)23)10-33-21(32)27-20(24)25/h2-6,11,19,30-31H,7-10H2,1H3,(H4,24,25,27,32) |
| InChIKey | UOOQYAODAWTUKT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 168.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|