C12H17ClN4O2 — CID 146027454
N-(diaminomethylidene)-5-methoxy-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride (PubChem CID 146027454) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-methoxy-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-5-methoxy-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146027454 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(diaminomethylidene)-5-methoxy-1-methyl-2,3-dihydroindole-2-carboxamide;hydrochloride |
| SMILES | COc1ccc2c(c1)CC(C(=O)N=C(N)N)N2C.Cl |
| InChI | InChI=1S/C12H16N4O2.ClH/c1-16-9-4-3-8(18-2)5-7(9)6-10(16)11(17)15-12(13)14;/h3-5,10H,6H2,1-2H3,(H4,13,14,15,17);1H |
| InChIKey | CBFCKUIWYMLQKZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|