C30H49F2NO4Si — CID 146027477
propan-2-yl 7-[(2S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 146027477) has the molecular formula C30H49F2NO4Si and a molecular weight of 553.81 g/mol. Its IUPAC name is propan-2-yl 7-[(2S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[(2S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 146027477 |
| Molecular Formula | C30H49F2NO4Si |
| Molecular Weight | 553.81 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | propan-2-yl 7-[(2S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluoro-4-phenylbutyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCN1C(=O)CC[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C30H49F2NO4Si/c1-23(2)36-28(35)17-13-8-9-14-22-33-25(19-21-27(33)34)18-20-26(37-38(6,7)29(3,4)5)30(31,32)24-15-11-10-12-16-24/h10-12,15-16,23,25-26H,8-9,13-14,17-22H2,1-7H3/t25-,26-/m0/s1 |
| InChIKey | LSLQVMANYPLQRW-UIOOFZCWSA-N |
| XLogP | 7.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.81 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|